CAS 1621438-71-8 appears in our catalog under these names: 4-Chloro-3-(cyclopropylaminocarbonyl)phenylboronic acid pinacol ester, 98%, 4-Chloro-3-(cyclopropylaminocarbonyl)phenylboronic acid pinacol ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
2-chloro-N-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1621438-71-8) is a chemical compound with the molecular formula C16H21BClNO3 and a molecular weight of 321.6 g/mol. IUPAC name: 2-chloro-N-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: JYYZOEZRCJOJAM-UHFFFAOYSA-N.
| Molecular formula | C16H21BClNO3 |
|---|---|
| Molecular weight | 321.6 g/mol |
| IUPAC name | 2-chloro-N-cyclopropyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | JYYZOEZRCJOJAM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)Cl)C(=O)NC3CC3 |
Computed by PubChem (NCBI)