CAS 1621686-10-9 appears in our catalog under these names: 2-Amino-4,4-dimethyl-4,5,6,7-tetrahydro-1,3-benzothiazol-5-one, 95%, 2-amino-4,4-dimethyl-6,7-dihydrobenzo(d)thiazol-5(4H)-one, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 25g.
2-amino-4,4-dimethyl-6,7-dihydro-1,3-benzothiazol-5-one (CAS 1621686-10-9) is a chemical compound with the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. IUPAC name: 2-amino-4,4-dimethyl-6,7-dihydro-1,3-benzothiazol-5-one. InChIKey: AFXWBYHBKNUUMQ-UHFFFAOYSA-N.
| Molecular formula | C9H12N2OS |
|---|---|
| Molecular weight | 196.27 g/mol |
| IUPAC name | 2-amino-4,4-dimethyl-6,7-dihydro-1,3-benzothiazol-5-one |
| InChIKey | AFXWBYHBKNUUMQ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)CCC2=C1N=C(S2)N)C |
Computed by PubChem (NCBI)