CAS 16218-32-9 appears in our catalog under these names: 2,7-Diiodophenanthrene-9,10-dione, 95%, 2,7-Diiodophenanthrene-9,10-dione 98%, 2,7-Diiodophenanthrene-9,10-dione, 97%, 97%, 2,7-Diiodophenanthrene-9,10-dione, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2,7-diiodophenanthrene-9,10-dione (CAS 16218-32-9) is a chemical compound with the molecular formula C14H6I2O2 and a molecular weight of 460.00 g/mol. IUPAC name: 2,7-diiodophenanthrene-9,10-dione. InChIKey: FJEXTLBWOUQIBN-UHFFFAOYSA-N.
| Molecular formula | C14H6I2O2 |
|---|---|
| Molecular weight | 460.00 g/mol |
| IUPAC name | 2,7-diiodophenanthrene-9,10-dione |
| InChIKey | FJEXTLBWOUQIBN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1I)C(=O)C(=O)C3=C2C=CC(=C3)I |
Computed by PubChem (NCBI)