CAS 1621910-10-8 is the registry number for tert-Butyl 4-(5-bromo-1H-pyrazol-1-yl)piperidine-1-carboxylate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Tert-butyl 4-(5-bromopyrazol-1-yl)piperidine-1-carboxylate (CAS 1621910-10-8) is a chemical compound with the molecular formula C13H20BrN3O2 and a molecular weight of 330.22 g/mol. IUPAC name: tert-butyl 4-(5-bromopyrazol-1-yl)piperidine-1-carboxylate. InChIKey: ORPJARXRVYEZJQ-UHFFFAOYSA-N.
| Molecular formula | C13H20BrN3O2 |
|---|---|
| Molecular weight | 330.22 g/mol |
| IUPAC name | tert-butyl 4-(5-bromopyrazol-1-yl)piperidine-1-carboxylate |
| InChIKey | ORPJARXRVYEZJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)N2C(=CC=N2)Br |
Computed by PubChem (NCBI)