CAS 162193-53-5 appears in our catalog under these names: Amidotrizoic Acid Impurity 3(Amidotrizoic Acid EP Impurity C), 4-Deiodo-amidotrizoic Acid, >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
3,5-diacetamido-2,6-diiodobenzoic acid (CAS 162193-53-5) is a chemical compound with the molecular formula C11H10I2N2O4 and a molecular weight of 488.02 g/mol. IUPAC name: 3,5-diacetamido-2,6-diiodobenzoic acid. InChIKey: FMBYKVSRFAJNHZ-UHFFFAOYSA-N.
| Molecular formula | C11H10I2N2O4 |
|---|---|
| Molecular weight | 488.02 g/mol |
| IUPAC name | 3,5-diacetamido-2,6-diiodobenzoic acid |
| InChIKey | FMBYKVSRFAJNHZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=C(C(=C1I)C(=O)O)I)NC(=O)C |
Computed by PubChem (NCBI)