Products 1621962-53-5
CAS 1621962-53-5 is the registry number for ((3-(Aminomethyl)benzyl)imino)dimethyl-l6-sulfanone hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-[[[dimethyl(oxo)-lambda6-sulfanylidene]amino]methyl]phenyl]methanamine;hydrochloride (CAS 1621962-53-5) is a chemical compound with the molecular formula C10H17ClN2OS and a molecular weight of 248.77 g/mol. IUPAC name: [3-[[[dimethyl(oxo)-lambda6-sulfanylidene]amino]methyl]phenyl]methanamine;hydrochloride. InChIKey: GHSKVFBTTMTMNH-UHFFFAOYSA-N.
| Molecular formula | C10H17ClN2OS |
|---|---|
| Molecular weight | 248.77 g/mol |
| IUPAC name | [3-[[[dimethyl(oxo)-lambda6-sulfanylidene]amino]methyl]phenyl]methanamine;hydrochloride |
| InChIKey | GHSKVFBTTMTMNH-UHFFFAOYSA-N |
| SMILES | CS(=NCC1=CC=CC(=C1)CN)(=O)C.Cl |
Computed by PubChem (NCBI)