Products 1621996-17-5
CAS 1621996-17-5 is the registry number for 1-Bromo-4-((3-methylbut-3-en-2-yl)oxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-bromo-4-(3-methylbut-3-en-2-yloxy)benzene (CAS 1621996-17-5) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 1-bromo-4-(3-methylbut-3-en-2-yloxy)benzene. InChIKey: NEFCBANZVNKIBM-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 1-bromo-4-(3-methylbut-3-en-2-yloxy)benzene |
| InChIKey | NEFCBANZVNKIBM-UHFFFAOYSA-N |
| SMILES | CC(C(=C)C)OC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)