CAS 1622006-09-0 appears in our catalog under these names: Radioprotectin-1, 99+%, Radioprotectin-1/ 98.75% (existing batch purity), 5-chloro-2-[(4-{2,4-dioxo-3-azatricyclo[7.3.1.0,5,13]trideca-1(13),5,7,9,11-pentaen-3-yl}butyl)sulfamoyl]benzoic acid, Radioprotectin-1, 99.49%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 50 mg, 10mM/1mL.
5-chloro-2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid (CAS 1622006-09-0) is a chemical compound with the molecular formula C23H19ClN2O6S and a molecular weight of 486.9 g/mol. IUPAC name: 5-chloro-2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid. InChIKey: OVJUYQCJIFWMBI-UHFFFAOYSA-N.
| Molecular formula | C23H19ClN2O6S |
|---|---|
| Molecular weight | 486.9 g/mol |
| IUPAC name | 5-chloro-2-[4-(1,3-dioxobenzo[de]isoquinolin-2-yl)butylsulfamoyl]benzoic acid |
| InChIKey | OVJUYQCJIFWMBI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)CCCCNS(=O)(=O)C4=C(C=C(C=C4)Cl)C(=O)O |
Computed by PubChem (NCBI)