CAS 1622217-15-5 is the registry number for 6-Trifluoromethylpyridine-2,4-diboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine (CAS 1622217-15-5) is a chemical compound with the molecular formula C18H26B2F3NO4 and a molecular weight of 399.0 g/mol. IUPAC name: 2,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine. InChIKey: WYXSJKWEYULIFJ-UHFFFAOYSA-N.
| Molecular formula | C18H26B2F3NO4 |
|---|---|
| Molecular weight | 399.0 g/mol |
| IUPAC name | 2,4-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine |
| InChIKey | WYXSJKWEYULIFJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=NC(=C2)C(F)(F)F)B3OC(C(O3)(C)C)(C)C |
Computed by PubChem (NCBI)