CAS 1622290-42-9 is the registry number for 2-(4-(Dibenzo[b,d]furan-2-yl)phenyl)-4,6-diphenyl-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(4-dibenzofuran-2-ylphenyl)-4,6-diphenyl-1,3,5-triazine (CAS 1622290-42-9) is a chemical compound with the molecular formula C33H21N3O and a molecular weight of 475.5 g/mol. IUPAC name: 2-(4-dibenzofuran-2-ylphenyl)-4,6-diphenyl-1,3,5-triazine. InChIKey: UUKGQQQUPJXECD-UHFFFAOYSA-N.
| Molecular formula | C33H21N3O |
|---|---|
| Molecular weight | 475.5 g/mol |
| IUPAC name | 2-(4-dibenzofuran-2-ylphenyl)-4,6-diphenyl-1,3,5-triazine |
| InChIKey | UUKGQQQUPJXECD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)C4=CC5=C(C=C4)OC6=CC=CC=C65)C7=CC=CC=C7 |
Computed by PubChem (NCBI)