CAS 16223-74-8 is the registry number for Copper(ii)phthalate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Copper phthalate (CAS 16223-74-8) is a chemical compound with the molecular formula C8H4CuO4 and a molecular weight of 227.66 g/mol. IUPAC name: copper phthalate. InChIKey: GSCLWPQCXDSGBU-UHFFFAOYSA-L.
| Molecular formula | C8H4CuO4 |
|---|---|
| Molecular weight | 227.66 g/mol |
| IUPAC name | copper phthalate |
| InChIKey | GSCLWPQCXDSGBU-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)