Products 1622426-23-6

CAS 1622426-23-6 is the registry number for SERINE HYDROLASE INHIBITOR-20, >=95%. Offered by: Sigma-Aldrich. Available pack sizes: 5MG.

Structural formula: {0} (CAS {1})

Tert-butyl N-methyl-N-[2-[methyl(pyrazole-1-carbonyl)amino]ethyl]carbamate (CAS 1622426-23-6) is a chemical compound with the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. IUPAC name: tert-butyl N-methyl-N-[2-[methyl(pyrazole-1-carbonyl)amino]ethyl]carbamate. InChIKey: YEPRRJPGFVACBT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22N4O3
Molecular weight282.34 g/mol
IUPAC nametert-butyl N-methyl-N-[2-[methyl(pyrazole-1-carbonyl)amino]ethyl]carbamate
InChIKeyYEPRRJPGFVACBT-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N(C)CCN(C)C(=O)N1C=CC=N1

Computed by PubChem (NCBI)