Products 1622429-53-1
CAS 1622429-53-1 appears in our catalog under these names: Lipoxin A4–d5, Lipoxin A4-d5. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10μg, 100μg, 25μg, 50μg, 25 μg.
(5S,6R,7E,9E,11Z,13E,15S)-19,19,20,20,20-pentadeuterio-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoic acid (CAS 1622429-53-1) is a chemical compound with the molecular formula C20H32O5 and a molecular weight of 357.5 g/mol. IUPAC name: (5S,6R,7E,9E,11Z,13E,15S)-19,19,20,20,20-pentadeuterio-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoic acid. InChIKey: IXAQOQZEOGMIQS-YUMLLTTFSA-N.
| Molecular formula | C20H32O5 |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | (5S,6R,7E,9E,11Z,13E,15S)-19,19,20,20,20-pentadeuterio-5,6,15-trihydroxyicosa-7,9,11,13-tetraenoic acid |
| InChIKey | IXAQOQZEOGMIQS-YUMLLTTFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CCC[C@@H](\C=C\C=C/C=C/C=C/[C@H]([C@H](CCCC(=O)O)O)O)O |
Computed by PubChem (NCBI)