CAS 162258-86-8 appears in our catalog under these names: 4-(Trifluoromethyl)thiophenylhydrazine hydrochloride, 95%, 4-(Trifluoromethyl)thiophenylhydrazine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 1000mg, 500mg, 2000mg, 5000mg, 10000mg.
[4-(trifluoromethylsulfanyl)phenyl]hydrazine;hydrochloride (CAS 162258-86-8) is a chemical compound with the molecular formula C7H8ClF3N2S and a molecular weight of 244.67 g/mol. IUPAC name: [4-(trifluoromethylsulfanyl)phenyl]hydrazine;hydrochloride. InChIKey: CTYHWWILICBYGZ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClF3N2S |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | [4-(trifluoromethylsulfanyl)phenyl]hydrazine;hydrochloride |
| InChIKey | CTYHWWILICBYGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NN)SC(F)(F)F.Cl |
Computed by PubChem (NCBI)