Products 16226-24-7

CAS 16226-24-7 is the registry number for Ethyl 3-amino-2-(3,4-dimethoxyphenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-2-(3,4-dimethoxyphenyl)propanoate;hydrochloride (CAS 16226-24-7) is a chemical compound with the molecular formula C13H20ClNO4 and a molecular weight of 289.75 g/mol. IUPAC name: ethyl 3-amino-2-(3,4-dimethoxyphenyl)propanoate;hydrochloride. InChIKey: HGFYOLQSWMFANN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H20ClNO4
Molecular weight289.75 g/mol
IUPAC nameethyl 3-amino-2-(3,4-dimethoxyphenyl)propanoate;hydrochloride
InChIKeyHGFYOLQSWMFANN-UHFFFAOYSA-N
SMILESCCOC(=O)C(CN)C1=CC(=C(C=C1)OC)OC.Cl

Computed by PubChem (NCBI)