CAS 1622863-21-1 appears in our catalog under these names: Neoseptin 3, 97%, Neoseptin 3, Neoseptin 3, 99.21%. Offered by: AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 5mg, 100 mg, 25 mg, 50 mg, 10mM/1mL.
Tert-butyl (2S)-2-[[4-amino-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoate (CAS 1622863-21-1) is a chemical compound with the molecular formula C29H34N2O4 and a molecular weight of 474.6 g/mol. IUPAC name: tert-butyl (2S)-2-[[4-amino-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoate. InChIKey: OACODUCFPHHCIH-SANMLTNESA-N.
| Molecular formula | C29H34N2O4 |
|---|---|
| Molecular weight | 474.6 g/mol |
| IUPAC name | tert-butyl (2S)-2-[[4-amino-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoate |
| InChIKey | OACODUCFPHHCIH-SANMLTNESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCC1=CC=CC=C1)NC(=O)C2=CC(=C(C=C2)N)CCC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)