CAS 1622908-18-2 appears in our catalog under these names: Bipyrazone, Biscarfentrazone, >95% (HPLC), Biscarfentrazone, Bipyrazone , Bipyrazone , Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: on request, 25mg, 50mg, 5mg, 10mg, 100mg, 1x10mg, 1x1ml.
[1,3-dimethyl-4-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]pyrazol-5-yl] 1,3-dimethylpyrazole-4-carboxylate (CAS 1622908-18-2) is a chemical compound with the molecular formula C20H19F3N4O5S and a molecular weight of 484.5 g/mol. IUPAC name: [1,3-dimethyl-4-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]pyrazol-5-yl] 1,3-dimethylpyrazole-4-carboxylate. InChIKey: LALGZGDVRILFNW-UHFFFAOYSA-N.
| Molecular formula | C20H19F3N4O5S |
|---|---|
| Molecular weight | 484.5 g/mol |
| IUPAC name | [1,3-dimethyl-4-[2-methylsulfonyl-4-(trifluoromethyl)benzoyl]pyrazol-5-yl] 1,3-dimethylpyrazole-4-carboxylate |
| InChIKey | LALGZGDVRILFNW-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C(=O)OC2=C(C(=NN2C)C)C(=O)C3=C(C=C(C=C3)C(F)(F)F)S(=O)(=O)C)C |
Computed by PubChem (NCBI)