Products 1622922-42-2
CAS 1622922-42-2 is the registry number for IDO1-IN-31. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[[3-(4-bromophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-3-(4-cyanophenyl)urea (CAS 1622922-42-2) is a chemical compound with the molecular formula C20H14BrN5OS and a molecular weight of 452.3 g/mol. IUPAC name: 1-[[3-(4-bromophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-3-(4-cyanophenyl)urea. InChIKey: RUPOOQKSFQRRDN-UHFFFAOYSA-N.
| Molecular formula | C20H14BrN5OS |
|---|---|
| Molecular weight | 452.3 g/mol |
| IUPAC name | 1-[[3-(4-bromophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-3-(4-cyanophenyl)urea |
| InChIKey | RUPOOQKSFQRRDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)NC(=O)NCC2=CN=C3N2C(=CS3)C4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)