CAS 1622923-40-3 appears in our catalog under these names: Potassium 4-ethoxycarbonylbenzoyltrifluoroborate, POTASSIUM 4-ETHOXYCARBONYLBENZOYLTRIFLUO. Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 0,5g, 1g, 2g, 10g, 5g.
Potassium (4-ethoxycarbonylbenzoyl)-trifluoroboranuide (CAS 1622923-40-3) is a chemical compound with the molecular formula C10H9BF3KO3 and a molecular weight of 284.08 g/mol. IUPAC name: potassium (4-ethoxycarbonylbenzoyl)-trifluoroboranuide. InChIKey: OVQLENWMAGNQJZ-UHFFFAOYSA-N.
| Molecular formula | C10H9BF3KO3 |
|---|---|
| Molecular weight | 284.08 g/mol |
| IUPAC name | potassium (4-ethoxycarbonylbenzoyl)-trifluoroboranuide |
| InChIKey | OVQLENWMAGNQJZ-UHFFFAOYSA-N |
| SMILES | [B-](C(=O)C1=CC=C(C=C1)C(=O)OCC)(F)(F)F.[K+] |
Computed by PubChem (NCBI)