CAS 1623010-63-8 appears in our catalog under these names: 9H-Thioxanthen-9-one, 2-[4-(diphenylamino)phenyl]-, 10,10-dioxide, 98%, Poly(9,9-di-(2-ethylhexyl)-fluorenyl-2,7-diyl) end capped with dimethylphenyl, 2–(4–(Diphenylamino)phenyl)–9H–thioxanthen–9–one 10,10–dioxide, TXO-TPA. Offered by: Chemat Brand, Lumtec, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 1g, 200MG.
10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one (CAS 1623010-63-8) is a chemical compound with the molecular formula C31H21NO3S and a molecular weight of 487.6 g/mol. IUPAC name: 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one. InChIKey: FGRBYDKOBBBPOI-UHFFFAOYSA-N.
| Molecular formula | C31H21NO3S |
|---|---|
| Molecular weight | 487.6 g/mol |
| IUPAC name | 10,10-dioxo-2-[4-(N-phenylanilino)phenyl]thioxanthen-9-one |
| InChIKey | FGRBYDKOBBBPOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC5=C(C=C4)S(=O)(=O)C6=CC=CC=C6C5=O |
Computed by PubChem (NCBI)