CAS 1623021-09-9 is the registry number for Methyl (5-bromoquinoxalin-6-yl)carbamimidothioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl N'-(5-bromoquinoxalin-6-yl)carbamimidothioate (CAS 1623021-09-9) is a chemical compound with the molecular formula C10H9BrN4S and a molecular weight of 297.18 g/mol. IUPAC name: methyl N'-(5-bromoquinoxalin-6-yl)carbamimidothioate. InChIKey: RCLLZSCIPUJGRR-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN4S |
|---|---|
| Molecular weight | 297.18 g/mol |
| IUPAC name | methyl N'-(5-bromoquinoxalin-6-yl)carbamimidothioate |
| InChIKey | RCLLZSCIPUJGRR-UHFFFAOYSA-N |
| SMILES | CSC(=NC1=C(C2=NC=CN=C2C=C1)Br)N |
Computed by PubChem (NCBI)