CAS 1623054-53-4 appears in our catalog under these names: Acesulfame-d4 Potassium Salt, >95% (HPLC), Acesulfame–d4 (potassium salt), Acesulfame-d4 (potassium). Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
Potassium 5-deuterio-2,2-dioxo-6-(trideuteriomethyl)-1-oxa-2lambda6-thia-3-azanidacyclohex-5-en-4-one (CAS 1623054-53-4) is a chemical compound with the molecular formula C4H4KNO4S and a molecular weight of 205.27 g/mol. IUPAC name: potassium 5-deuterio-2,2-dioxo-6-(trideuteriomethyl)-1-oxa-2lambda6-thia-3-azanidacyclohex-5-en-4-one. InChIKey: WBZFUFAFFUEMEI-LHHVLQQYSA-M.
| Molecular formula | C4H4KNO4S |
|---|---|
| Molecular weight | 205.27 g/mol |
| IUPAC name | potassium 5-deuterio-2,2-dioxo-6-(trideuteriomethyl)-1-oxa-2lambda6-thia-3-azanidacyclohex-5-en-4-one |
| InChIKey | WBZFUFAFFUEMEI-LHHVLQQYSA-M |
| SMILES | [2H]C1=C(OS(=O)(=O)[N-]C1=O)C([2H])([2H])[2H].[K+] |
Computed by PubChem (NCBI)