CAS 162358-09-0 appears in our catalog under these names: Fingolimod EP Impurity H, Fingolimod Impurity 10, N-(1,1-Bis((acetyloxy)methyl)-3-(4-octylphenyl)propyl)acetamide, 2-Acetamido-2-(4-octylphenethyl)propane-1,3-diyl diacetate, 95%, 95%, Tricetyl fingolimod, 95%. Offered by: Chemat Brand, TRC, Chemat, Ambeed. Available pack sizes: on request, 500mg, 50mg, 250mg, 1g, 5g.
[2-acetamido-2-(acetyloxymethyl)-4-(4-octylphenyl)butyl] acetate (CAS 162358-09-0) is a chemical compound with the molecular formula C25H39NO5 and a molecular weight of 433.6 g/mol. IUPAC name: [2-acetamido-2-(acetyloxymethyl)-4-(4-octylphenyl)butyl] acetate. InChIKey: GNDIBYIKXCMJGO-UHFFFAOYSA-N.
| Molecular formula | C25H39NO5 |
|---|---|
| Molecular weight | 433.6 g/mol |
| IUPAC name | [2-acetamido-2-(acetyloxymethyl)-4-(4-octylphenyl)butyl] acetate |
| InChIKey | GNDIBYIKXCMJGO-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC1=CC=C(C=C1)CCC(COC(=O)C)(COC(=O)C)NC(=O)C |
Computed by PubChem (NCBI)