CAS 162401-29-8 is the registry number for N-(3,5-Dichloropyridin-4-yl)-4-(difluoromethoxy)-3-methoxybenzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-methoxybenzamide (CAS 162401-29-8) is a chemical compound with the molecular formula C14H10Cl2F2N2O3 and a molecular weight of 363.1 g/mol. IUPAC name: N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-methoxybenzamide. InChIKey: SPLANDZBYAJGBL-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2F2N2O3 |
|---|---|
| Molecular weight | 363.1 g/mol |
| IUPAC name | N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)-3-methoxybenzamide |
| InChIKey | SPLANDZBYAJGBL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)NC2=C(C=NC=C2Cl)Cl)OC(F)F |
Computed by PubChem (NCBI)