Products 162404-35-5
CAS 162404-35-5 is the registry number for 3-Mercapto-3-methylbutan-1-ol-d6. Offered by: MedChemExpress. Available pack sizes: 1 mg.
1,1,2,2,4,4-hexadeuterio-3-methyl-3-sulfanylbutan-1-ol (CAS 162404-35-5) is a chemical compound with the molecular formula C5H12OS and a molecular weight of 126.25 g/mol. IUPAC name: 1,1,2,2,4,4-hexadeuterio-3-methyl-3-sulfanylbutan-1-ol. InChIKey: GBCGIJAYTBMFHI-ORNWBJTKSA-N.
| Molecular formula | C5H12OS |
|---|---|
| Molecular weight | 126.25 g/mol |
| IUPAC name | 1,1,2,2,4,4-hexadeuterio-3-methyl-3-sulfanylbutan-1-ol |
| InChIKey | GBCGIJAYTBMFHI-ORNWBJTKSA-N |
| SMILES | [2H]C([2H])C(C)(C([2H])([2H])C([2H])([2H])O)S |
Computed by PubChem (NCBI)