CAS 1624260-95-2 appears in our catalog under these names: 2-Trifluoromethyl-4-methylthiobenzaldehyde, 95%, 4-Methyl-2-(trifluoromethyl)benzothialdehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
4-methyl-2-(trifluoromethyl)thiobenzaldehyde (CAS 1624260-95-2) is a chemical compound with the molecular formula C9H7F3S and a molecular weight of 204.21 g/mol. IUPAC name: 4-methyl-2-(trifluoromethyl)thiobenzaldehyde. InChIKey: FUTBITRAQSQEFP-UHFFFAOYSA-N.
| Molecular formula | C9H7F3S |
|---|---|
| Molecular weight | 204.21 g/mol |
| IUPAC name | 4-methyl-2-(trifluoromethyl)thiobenzaldehyde |
| InChIKey | FUTBITRAQSQEFP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C=S)C(F)(F)F |
Computed by PubChem (NCBI)