CAS 1624261-44-4 appears in our catalog under these names: 4-Bromo-1-methyl-1,2,3,6-tetrahydropyridine 4-methylbenzenesulfonate, 95%, 4-Bromo-1-methyl-1,2,3,6-tetrahydropyridine 4-methylbenzenesulfonate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4-bromo-1-methyl-3,6-dihydro-2H-pyridine;4-methylbenzenesulfonic acid (CAS 1624261-44-4) is a chemical compound with the molecular formula C13H18BrNO3S and a molecular weight of 348.26 g/mol. IUPAC name: 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;4-methylbenzenesulfonic acid. InChIKey: IYWKXPFYZFJEAP-UHFFFAOYSA-N.
| Molecular formula | C13H18BrNO3S |
|---|---|
| Molecular weight | 348.26 g/mol |
| IUPAC name | 4-bromo-1-methyl-3,6-dihydro-2H-pyridine;4-methylbenzenesulfonic acid |
| InChIKey | IYWKXPFYZFJEAP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CN1CCC(=CC1)Br |
Computed by PubChem (NCBI)