CAS 1624294-38-7 appears in our catalog under these names: 6,7-Bis(2-methoxyethoxy)-n-(3-vinylphenyl)quinazolin-4-amine hydrochloride, 95%, Erlotinib Impurity 43, Erlotinib Impurity 35, Erlotinib-3-vinyl hydrochloride. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: 250mg, 1g, 5g, on request, 10mg, 25mg, 50mg, 100mg.
N-(3-ethenylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;hydrochloride (CAS 1624294-38-7) is a chemical compound with the molecular formula C22H26ClN3O4 and a molecular weight of 431.9 g/mol. IUPAC name: N-(3-ethenylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;hydrochloride. InChIKey: PVYZSHZFBOSTSM-UHFFFAOYSA-N.
| Molecular formula | C22H26ClN3O4 |
|---|---|
| Molecular weight | 431.9 g/mol |
| IUPAC name | N-(3-ethenylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine;hydrochloride |
| InChIKey | PVYZSHZFBOSTSM-UHFFFAOYSA-N |
| SMILES | COCCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C=C)OCCOC.Cl |
Computed by PubChem (NCBI)