Products 1624332-57-5

CAS 1624332-57-5 is the registry number for Methyl 3′,4,5′-trimethoxy(1,1′-biphenyl)-2-propanoate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Methyl 3-[2-(3,5-dimethoxyphenyl)-5-methoxyphenyl]propanoate (CAS 1624332-57-5) is a chemical compound with the molecular formula C19H22O5 and a molecular weight of 330.4 g/mol. IUPAC name: methyl 3-[2-(3,5-dimethoxyphenyl)-5-methoxyphenyl]propanoate. InChIKey: DBYJRJQLPKHYTK-UHFFFAOYSA-N.

Identity
Molecular formulaC19H22O5
Molecular weight330.4 g/mol
IUPAC namemethyl 3-[2-(3,5-dimethoxyphenyl)-5-methoxyphenyl]propanoate
InChIKeyDBYJRJQLPKHYTK-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C2=CC(=CC(=C2)OC)OC)CCC(=O)OC

Computed by PubChem (NCBI)