CAS 1624606-96-7 appears in our catalog under these names: 7-Chloro-2-(difluoromethyl)-(1,3)thiazolo(5,4-d)pyrimidine, 95%, 7-Chloro-2-(difluoromethyl)-(1,3)thiazolo(5,4-d)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine (CAS 1624606-96-7) is a chemical compound with the molecular formula C6H2ClF2N3S and a molecular weight of 221.62 g/mol. IUPAC name: 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine. InChIKey: IHQNDGGDVOEBFB-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF2N3S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | 7-chloro-2-(difluoromethyl)-[1,3]thiazolo[5,4-d]pyrimidine |
| InChIKey | IHQNDGGDVOEBFB-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=N1)Cl)N=C(S2)C(F)F |
Computed by PubChem (NCBI)