Products 162546-57-8
CAS 162546-57-8 is the registry number for 2,3-Difluoro-1-nitro-4-(trifluoromethoxy)benzene, 95+%. Offered by: Ambeed, BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
2,3-difluoro-1-nitro-4-(trifluoromethoxy)benzene (CAS 162546-57-8) is a chemical compound with the molecular formula C7H2F5NO3 and a molecular weight of 243.09 g/mol. IUPAC name: 2,3-difluoro-1-nitro-4-(trifluoromethoxy)benzene. InChIKey: SQKRTXJGOAZLFD-UHFFFAOYSA-N.
| Molecular formula | C7H2F5NO3 |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | 2,3-difluoro-1-nitro-4-(trifluoromethoxy)benzene |
| InChIKey | SQKRTXJGOAZLFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])F)F)OC(F)(F)F |
Computed by PubChem (NCBI)