Products 1625629-51-7
CAS 1625629-51-7 appears in our catalog under these names: MCAAD–3, MCAAD-3, 96.12%, Methyl (2E,4E,6E)-2-cyano-7-(4-(dimethylamino)phenyl)hepta-2,4,6-trienoate, 99%, Methyl (2E,4E,6E)-2-cyano-7-(4-(dimethylamino)phenyl)hepta-2,4,6-trienoate, 98%. Offered by: GLPBio, MedChemExpress, BLDpharm, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 10 mg, 5 mg, 25 mg, 50mg, 100mg.
Methyl (2Z,4E,6E)-2-cyano-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienoate (CAS 1625629-51-7) is a chemical compound with the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. IUPAC name: methyl (2Z,4E,6E)-2-cyano-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienoate. InChIKey: VUICGFIMDGFKFH-FGHSSWIZSA-N.
| Molecular formula | C17H18N2O2 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | methyl (2Z,4E,6E)-2-cyano-7-[4-(dimethylamino)phenyl]hepta-2,4,6-trienoate |
| InChIKey | VUICGFIMDGFKFH-FGHSSWIZSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=C/C=C/C=C(/C#N)\C(=O)OC |
Computed by PubChem (NCBI)