CAS 16257-83-3 appears in our catalog under these names: (2S,4S)–4–Aminopyrrolidine–2–carboxylic acid, H-cis-4-NH2-Pro-OH 95%, (2S,4S)-4-Aminopyrrolidine-2-carboxylic acid, 95%, 95%, (2S,4S)-4-aminopyrrolidine-2-carboxylic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S,4S)-4-aminopyrrolidine-2-carboxylic acid (CAS 16257-83-3) is a chemical compound with the molecular formula C5H10N2O2 and a molecular weight of 130.15 g/mol. IUPAC name: (2S,4S)-4-aminopyrrolidine-2-carboxylic acid. InChIKey: SHINASQYHDCLEU-IMJSIDKUSA-N.
| Molecular formula | C5H10N2O2 |
|---|---|
| Molecular weight | 130.15 g/mol |
| IUPAC name | (2S,4S)-4-aminopyrrolidine-2-carboxylic acid |
| InChIKey | SHINASQYHDCLEU-IMJSIDKUSA-N |
| SMILES | C1[C@@H](CN[C@@H]1C(=O)O)N |
Computed by PubChem (NCBI)