CAS 1626-24-0 appears in our catalog under these names: Triphenylgermanium chloride, 95%, Triphenylchlorogermane, Triphenylchlorogermane, >97.0%(GC), TRIPHENYLGERMANIUM CHLORIDE, 97%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 1g, 5g.
Chloro(triphenyl)germane (CAS 1626-24-0) is a chemical compound with the molecular formula C18H15ClGe and a molecular weight of 339.4 g/mol. IUPAC name: chloro(triphenyl)germane. InChIKey: ONQMBYVVEVFYRP-UHFFFAOYSA-N.
| Molecular formula | C18H15ClGe |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | chloro(triphenyl)germane |
| InChIKey | ONQMBYVVEVFYRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Ge](C2=CC=CC=C2)(C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)