CAS 1626335-94-1 is the registry number for 3-Amino-1H-indazole-7-boronic acid pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 100mg.
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-amine (CAS 1626335-94-1) is a chemical compound with the molecular formula C13H18BN3O2 and a molecular weight of 259.11 g/mol. IUPAC name: 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-amine. InChIKey: MNGUVGDDCFPANK-UHFFFAOYSA-N.
| Molecular formula | C13H18BN3O2 |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-3-amine |
| InChIKey | MNGUVGDDCFPANK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C(=NN3)N |
Computed by PubChem (NCBI)