CAS 1626343-37-0 is the registry number for (3R,5S)-1-Benzyl-5-methylpyrrolidin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,5S)-1-benzyl-5-methylpyrrolidin-3-amine (CAS 1626343-37-0) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: (3R,5S)-1-benzyl-5-methylpyrrolidin-3-amine. InChIKey: GEZSNOKHPRRTIC-CMPLNLGQSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | (3R,5S)-1-benzyl-5-methylpyrrolidin-3-amine |
| InChIKey | GEZSNOKHPRRTIC-CMPLNLGQSA-N |
| SMILES | C[C@H]1C[C@H](CN1CC2=CC=CC=C2)N |
Computed by PubChem (NCBI)