Products 16264-05-4
CAS 16264-05-4 is the registry number for 1,4-Bis(4-nitrophenyl)piperazine, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg.
1,4-bis(4-nitrophenyl)piperazine (CAS 16264-05-4) is a chemical compound with the molecular formula C16H16N4O4 and a molecular weight of 328.32 g/mol. IUPAC name: 1,4-bis(4-nitrophenyl)piperazine. InChIKey: VCZGAOMAWKGNEF-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O4 |
|---|---|
| Molecular weight | 328.32 g/mol |
| IUPAC name | 1,4-bis(4-nitrophenyl)piperazine |
| InChIKey | VCZGAOMAWKGNEF-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)[N+](=O)[O-])C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)