CAS 1626482-00-5 is the registry number for Ethyl (2s,3s)-3-aminobicyclo[2.2.2]octane-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
Ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate (CAS 1626482-00-5) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate. InChIKey: CFRDVZHAVFJIFL-QLEHZGMVSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | ethyl (2S,3S)-3-aminobicyclo[2.2.2]octane-2-carboxylate |
| InChIKey | CFRDVZHAVFJIFL-QLEHZGMVSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@H](C2CCC1CC2)N |
Computed by PubChem (NCBI)