CAS 1627202-38-3 appears in our catalog under these names: Regadenoson Impurity 5, 2-(1H-Pyrazol-1-yl)adenosine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(2R,3R,4S,5R)-2-(6-amino-2-pyrazol-1-ylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 1627202-38-3) is a chemical compound with the molecular formula C13H15N7O4 and a molecular weight of 333.30 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-2-pyrazol-1-ylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: YCYRZUFNEBQHBF-WOUKDFQISA-N.
| Molecular formula | C13H15N7O4 |
|---|---|
| Molecular weight | 333.30 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-2-pyrazol-1-ylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | YCYRZUFNEBQHBF-WOUKDFQISA-N |
| SMILES | C1=CN(N=C1)C2=NC(=C3C(=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O)N |
Computed by PubChem (NCBI)