CAS 1627507-23-6 is the registry number for 5-Bromo-3-fluoro-1-(4-methoxybenzyl)-1H-1,2,4-triazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-fluoro-1-[(4-methoxyphenyl)methyl]-1,2,4-triazole (CAS 1627507-23-6) is a chemical compound with the molecular formula C10H9BrFN3O and a molecular weight of 286.10 g/mol. IUPAC name: 5-bromo-3-fluoro-1-[(4-methoxyphenyl)methyl]-1,2,4-triazole. InChIKey: QJTQFUDSPMOMOM-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFN3O |
|---|---|
| Molecular weight | 286.10 g/mol |
| IUPAC name | 5-bromo-3-fluoro-1-[(4-methoxyphenyl)methyl]-1,2,4-triazole |
| InChIKey | QJTQFUDSPMOMOM-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C(=NC(=N2)F)Br |
Computed by PubChem (NCBI)