Products 1627580-82-8
CAS 1627580-82-8 is the registry number for MIPS1455. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(4-benzoylphenyl)methyl]-4-oxoquinoline-3-carboxylic acid (CAS 1627580-82-8) is a chemical compound with the molecular formula C24H17NO4 and a molecular weight of 383.4 g/mol. IUPAC name: 1-[(4-benzoylphenyl)methyl]-4-oxoquinoline-3-carboxylic acid. InChIKey: RFONOEROIUQAJO-UHFFFAOYSA-N.
| Molecular formula | C24H17NO4 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 1-[(4-benzoylphenyl)methyl]-4-oxoquinoline-3-carboxylic acid |
| InChIKey | RFONOEROIUQAJO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)CN3C=C(C(=O)C4=CC=CC=C43)C(=O)O |
Computed by PubChem (NCBI)