Products 1627894-70-5

CAS 1627894-70-5 appears in our catalog under these names: 2-(Difluoromethyl)-1,3-oxazole-4-carboxylic acid, 95%, 2-(Difluoromethyl)-1,3-oxazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(difluoromethyl)-1,3-oxazole-4-carboxylic acid (CAS 1627894-70-5) is a chemical compound with the molecular formula C5H3F2NO3 and a molecular weight of 163.08 g/mol. IUPAC name: 2-(difluoromethyl)-1,3-oxazole-4-carboxylic acid. InChIKey: PCMYMMDQSRAGMU-UHFFFAOYSA-N.

Identity
Molecular formulaC5H3F2NO3
Molecular weight163.08 g/mol
IUPAC name2-(difluoromethyl)-1,3-oxazole-4-carboxylic acid
InChIKeyPCMYMMDQSRAGMU-UHFFFAOYSA-N
SMILESC1=C(N=C(O1)C(F)F)C(=O)O

Computed by PubChem (NCBI)