Products 162797-33-3
CAS 162797-33-3 is the registry number for Paeciloquinone A. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3,6,8-tetrahydroxy-2-(2-oxooxolan-3-yl)anthracene-9,10-dione (CAS 162797-33-3) is a chemical compound with the molecular formula C18H12O8 and a molecular weight of 356.3 g/mol. IUPAC name: 1,3,6,8-tetrahydroxy-2-(2-oxooxolan-3-yl)anthracene-9,10-dione. InChIKey: CCJBPPLPVJLTRD-UHFFFAOYSA-N.
| Molecular formula | C18H12O8 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | 1,3,6,8-tetrahydroxy-2-(2-oxooxolan-3-yl)anthracene-9,10-dione |
| InChIKey | CCJBPPLPVJLTRD-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C1C2=C(C=C3C(=C2O)C(=O)C4=C(C3=O)C=C(C=C4O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Paeciloquinone A, orb3024616