Products 162797-34-4
CAS 162797-34-4 is the registry number for Paeciloquinone B. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-oxo-2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)hexanoic acid (CAS 162797-34-4) is a chemical compound with the molecular formula C20H16O9 and a molecular weight of 400.3 g/mol. IUPAC name: 5-oxo-2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)hexanoic acid. InChIKey: HTBJCSXYMPBHJQ-UHFFFAOYSA-N.
| Molecular formula | C20H16O9 |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | 5-oxo-2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)hexanoic acid |
| InChIKey | HTBJCSXYMPBHJQ-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC(C1=C(C=C2C(=C1O)C(=O)C3=C(C2=O)C=C(C=C3O)O)O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Paeciloquinone B, orb3024686