CAS 1627971-54-3 is the registry number for 6-Bromo-1-(3-fluorobenzyl)indoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-bromo-1-[(3-fluorophenyl)methyl]-2,3-dihydroindole (CAS 1627971-54-3) is a chemical compound with the molecular formula C15H13BrFN and a molecular weight of 306.17 g/mol. IUPAC name: 6-bromo-1-[(3-fluorophenyl)methyl]-2,3-dihydroindole. InChIKey: DGGAAOZGJFXOLS-UHFFFAOYSA-N.
| Molecular formula | C15H13BrFN |
|---|---|
| Molecular weight | 306.17 g/mol |
| IUPAC name | 6-bromo-1-[(3-fluorophenyl)methyl]-2,3-dihydroindole |
| InChIKey | DGGAAOZGJFXOLS-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=CC(=C2)Br)CC3=CC(=CC=C3)F |
Computed by PubChem (NCBI)