CAS 1628-78-0 is the registry number for Methylene Blue Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
2,7-dinitro-10H-phenothiazine (CAS 1628-78-0) is a chemical compound with the molecular formula C12H7N3O4S and a molecular weight of 289.27 g/mol. IUPAC name: 2,7-dinitro-10H-phenothiazine. InChIKey: POTOOUSABZIBKN-UHFFFAOYSA-N.
| Molecular formula | C12H7N3O4S |
|---|---|
| Molecular weight | 289.27 g/mol |
| IUPAC name | 2,7-dinitro-10H-phenothiazine |
| InChIKey | POTOOUSABZIBKN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])SC3=C(N2)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)