CAS 16283-36-6 appears in our catalog under these names: Zinc Salicylate Hydrate, (T-4)-Bis[2-(hydroxy-κO)benzoato-κO]zinc, 95%, 95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 2,5g, 5g, 250mg, 10g, 25g, 50g.
Zinc bis(2-carboxyphenolate) (CAS 16283-36-6) is a chemical compound with the molecular formula C14H10O6Zn and a molecular weight of 339.6 g/mol. IUPAC name: zinc bis(2-carboxyphenolate). InChIKey: PZXFWBWBWODQCS-UHFFFAOYSA-L.
| Molecular formula | C14H10O6Zn |
|---|---|
| Molecular weight | 339.6 g/mol |
| IUPAC name | zinc bis(2-carboxyphenolate) |
| InChIKey | PZXFWBWBWODQCS-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=C1)C(=O)O)[O-].C1=CC=C(C(=C1)C(=O)O)[O-].[Zn+2] |
Computed by PubChem (NCBI)