CAS 1628319-93-6 appears in our catalog under these names: tert-butyl (1S,4S,6R)-6-amino-2-azabicyclo(2.2.1)heptane-2-carboxylate, 97%, tert-Butyl (1S,4S,6R)-6-amino-2- azabicyclo[2.2.1]heptane-2- carboxylate, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Tert-butyl (1S,4S,6R)-6-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 1628319-93-6) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl (1S,4S,6R)-6-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: WDLJVXLPYIOWOZ-YIZRAAEISA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl (1S,4S,6R)-6-amino-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | WDLJVXLPYIOWOZ-YIZRAAEISA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C[C@H]([C@@H]1C2)N |
Computed by PubChem (NCBI)