CAS 16285-82-8 appears in our catalog under these names: Trimethoprim Impurity F, Trimethoprim EP Impurity F, 3-Desmethoxy-3-bromo Trimethoprim, >95% (HPLC), 5-(3-Bromo-4,5-dimethoxybenzyl)pyrimidine-2,4-diamine, 3-Desmethoxy-3-bromo Trimethoprim. Offered by: Chemat Brand, TRC, Mikromol, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 100mg, 25mg, 50mg, 250mg, 1g.
5-[(3-bromo-4,5-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine (CAS 16285-82-8) is a chemical compound with the molecular formula C13H15BrN4O2 and a molecular weight of 339.19 g/mol. IUPAC name: 5-[(3-bromo-4,5-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine. InChIKey: XJSNBPJINGRLAM-UHFFFAOYSA-N.
| Molecular formula | C13H15BrN4O2 |
|---|---|
| Molecular weight | 339.19 g/mol |
| IUPAC name | 5-[(3-bromo-4,5-dimethoxyphenyl)methyl]pyrimidine-2,4-diamine |
| InChIKey | XJSNBPJINGRLAM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)CC2=CN=C(N=C2N)N)Br)OC |
Computed by PubChem (NCBI)