Products 162853-20-5
CAS 162853-20-5 appears in our catalog under these names: 1-(4-Hydroxy-5-methoxy-2-methylphenyl)ethan-1-one, 95%, 1–(4–Hydroxy–5–methoxy–2–methylphenyl)ethanone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
1-(4-hydroxy-5-methoxy-2-methylphenyl)ethanone (CAS 162853-20-5) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 1-(4-hydroxy-5-methoxy-2-methylphenyl)ethanone. InChIKey: UPNIEPOAEOTDBC-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 1-(4-hydroxy-5-methoxy-2-methylphenyl)ethanone |
| InChIKey | UPNIEPOAEOTDBC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)C)OC)O |
Computed by PubChem (NCBI)